CAS 1261889-11-5

4-(2-Furanyl)-2-nitrobenzoic acid

Description:

4-(2-Furanyl)-2-nitrobenzoic acid is an organic compound characterized by its unique structure, which includes a furan ring and a nitro group attached to a benzoic acid moiety. The presence of the furan ring contributes to its aromatic properties, while the nitro group introduces electron-withdrawing characteristics, influencing the compound's reactivity and polarity. This compound typically exhibits moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. Its functional groups suggest potential applications in organic synthesis, pharmaceuticals, or as intermediates in chemical reactions. The compound's molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its physical properties, such as melting point and boiling point. Additionally, the presence of both acidic (carboxylic acid) and aromatic functionalities may provide opportunities for further derivatization or complexation with other molecules. Overall, 4-(2-Furanyl)-2-nitrobenzoic acid is a versatile compound with potential utility in various chemical applications.

Formula: C₁₁H₇NO₅

InChI: InChI=1S/C11H7NO5/c13-11(14)8-4-3-7(6-9(8)12(15)16)10-2-1-5-17-10/h1-6H,(H,13,14)

InChI key: InChIKey=YZHGOQHEXMTPTP-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C(C=CC1C(O)=O)C2=CC=CO2

Synonyms:

• Benzoic acid, 4-(2-furanyl)-2-nitro-
• 4-(2-Furanyl)-2-nitrobenzoic acid