CymitQuimica logo

CAS 1261889-16-0

:

4-(1-Naphthalenyl)-2(1H)-pyridinone

Description:
4-(1-Naphthalenyl)-2(1H)-pyridinone, also known by its CAS number 1261889-16-0, is an organic compound characterized by its unique structure that combines a naphthalene moiety with a pyridinone ring. This compound typically exhibits properties associated with both aromatic systems, such as stability and potential for π-π stacking interactions. The presence of the pyridinone functional group suggests it may exhibit basicity due to the nitrogen atom in the pyridine ring, as well as potential for hydrogen bonding due to the carbonyl group in the pyridinone. Such characteristics may contribute to its solubility in organic solvents and its reactivity in various chemical reactions, including nucleophilic substitutions or cyclizations. Additionally, compounds of this type may possess biological activity, making them of interest in medicinal chemistry and drug development. Overall, 4-(1-Naphthalenyl)-2(1H)-pyridinone represents a versatile scaffold for further chemical exploration and application.
Formula:C15H11NO
InChI:InChI=1S/C15H11NO/c17-15-10-12(8-9-16-15)14-7-3-5-11-4-1-2-6-13(11)14/h1-10H,(H,16,17)
InChI key:InChIKey=COZXGFSPHLZPHB-UHFFFAOYSA-N
SMILES:O=C1C=C(C=2C3=C(C=CC2)C=CC=C3)C=CN1
Synonyms:
  • 4-(1-Naphthalenyl)-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 4-(1-naphthalenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.