CAS 1261889-24-0

2′-Hydroxy-2-methoxy[1,1′-biphenyl]-4-carboxylic acid

Description:

2′-Hydroxy-2-methoxy[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) and a methoxy group (-OCH3) at the 2' position of the biphenyl, contributing to its solubility and reactivity. The presence of a carboxylic acid group (-COOH) at the 4-position enhances its acidity and polar characteristics, making it more soluble in polar solvents. This compound may exhibit various biological activities due to its functional groups, potentially acting as an antioxidant or having other pharmacological properties. Its molecular structure allows for intramolecular hydrogen bonding, which can influence its stability and reactivity. Additionally, the compound's unique arrangement of substituents can affect its interaction with other molecules, making it of interest in fields such as medicinal chemistry and materials science. Overall, 2′-Hydroxy-2-methoxy[1,1′-biphenyl]-4-carboxylic acid is a versatile compound with potential applications in various chemical and biological contexts.

Formula: C₁₄H₁₂O₄

InChI: InChI=1S/C14H12O4/c1-18-13-8-9(14(16)17)6-7-11(13)10-4-2-3-5-12(10)15/h2-8,15H,1H3,(H,16,17)

InChI key: InChIKey=CRTZTEWYCLLWHE-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC(C(O)=O)=C1)C2=C(O)C=CC=C2

Synonyms:

• 2′-Hydroxy-2-methoxy[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 2′-hydroxy-2-methoxy-