CymitQuimica logo

CAS 1261889-94-4

:

Methyl 4′-cyano-6-fluoro-3′-hydroxy[1,1′-biphenyl]-3-carboxylate

Description:
Methyl 4′-cyano-6-fluoro-3′-hydroxy[1,1′-biphenyl]-3-carboxylate is an organic compound characterized by its complex structure, which includes a biphenyl core substituted with various functional groups. The presence of a cyano group (-CN) and a fluoro group (-F) indicates potential reactivity and polarity, while the hydroxy group (-OH) contributes to its ability to engage in hydrogen bonding. The methyl ester functional group (-COOCH3) suggests that this compound may exhibit moderate solubility in organic solvents and could participate in esterification reactions. Its molecular structure implies potential applications in pharmaceuticals or agrochemicals, particularly due to the presence of the cyano and fluoro substituents, which can enhance biological activity or modify physical properties. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the biphenyl framework. Overall, this compound's unique combination of functional groups makes it a subject of interest in synthetic organic chemistry and materials science.
Formula:C15H10FNO3
InChI:InChI=1S/C15H10FNO3/c1-20-15(19)10-4-5-13(16)12(6-10)9-2-3-11(8-17)14(18)7-9/h2-7,18H,1H3
InChI key:InChIKey=IUACBUCZHKTOML-UHFFFAOYSA-N
SMILES:FC=1C(=CC(C(OC)=O)=CC1)C2=CC(O)=C(C#N)C=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 4′-cyano-6-fluoro-3′-hydroxy-, methyl ester
  • Methyl 4′-cyano-6-fluoro-3′-hydroxy[1,1′-biphenyl]-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.