CAS 1261890-15-6

5′-Fluoro-2′-methyl-5-nitro[1,1′-biphenyl]-2-carboxylic acid

Description:

5′-Fluoro-2′-methyl-5-nitro[1,1′-biphenyl]-2-carboxylic acid is a chemical compound characterized by its complex biphenyl structure, which includes a fluoro group, a methyl group, and a nitro group, as well as a carboxylic acid functional group. The presence of the fluoro substituent typically enhances the compound's lipophilicity and can influence its biological activity. The nitro group is known for its potential to participate in redox reactions, while the carboxylic acid group contributes to the compound's acidity and solubility in polar solvents. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its molecular interactions can be influenced by the spatial arrangement of the substituents, which may affect its reactivity and binding affinity to biological targets. Overall, the unique combination of functional groups and structural characteristics makes this compound a valuable candidate for further research in various chemical and biological applications.

Formula: C₁₄H₁₀FNO₄

InChI: InChI=1S/C14H10FNO4/c1-8-2-3-9(15)6-12(8)13-7-10(16(19)20)4-5-11(13)14(17)18/h2-7H,1H3,(H,17,18)

InChI key: InChIKey=GUPTVPDYJZXSSB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=C(N(=O)=O)C=C1)C2=C(C)C=CC(F)=C2

Synonyms:

• [1,1′-Biphenyl]-2-carboxylic acid, 5′-fluoro-2′-methyl-5-nitro-
• 5′-Fluoro-2′-methyl-5-nitro[1,1′-biphenyl]-2-carboxylic acid