CAS 1261890-18-9

2-Hydroxy-3′,5′-dimethyl[1,1′-biphenyl]-3-carboxaldehyde

Description:

2-Hydroxy-3′,5′-dimethyl[1,1′-biphenyl]-3-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) and an aldehyde group (-CHO), contributing to its reactivity and potential applications in organic synthesis. The presence of two methyl groups at the 3′ and 5′ positions enhances its hydrophobic character and may influence its solubility in organic solvents. The hydroxyl group can participate in hydrogen bonding, affecting its physical properties such as boiling point and melting point. Additionally, the aldehyde functionality allows for further chemical transformations, making it a valuable intermediate in the synthesis of more complex molecules. Its unique structure may also impart specific biological activities, which could be of interest in medicinal chemistry. Overall, this compound exemplifies the diverse functionalities that can arise from modifications to a biphenyl framework, making it a subject of interest in both synthetic and applied chemistry.

Formula: C₁₅H₁₄O₂

InChI: InChI=1S/C15H14O2/c1-10-6-11(2)8-13(7-10)14-5-3-4-12(9-16)15(14)17/h3-9,17H,1-2H3

InChI key: InChIKey=NZESCINJPKXOML-UHFFFAOYSA-N

SMILES: OC1=C(C2=CC(C)=CC(C)=C2)C=CC=C1C=O

Synonyms:

• 2-Hydroxy-3′,5′-dimethyl[1,1′-biphenyl]-3-carboxaldehyde
• [1,1′-Biphenyl]-3-carboxaldehyde, 2-hydroxy-3′,5′-dimethyl-