
CAS 1261890-27-0
:3-Chloro-3′-fluoro-4′-hydroxy[1,1′-biphenyl]-2-carboxylic acid
Description:
3-Chloro-3′-fluoro-4′-hydroxy[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. The compound also features a hydroxyl group (-OH) and halogen substituents, specifically chlorine and fluorine, which can influence its reactivity and solubility. The chlorine and fluorine atoms introduce electronegative elements that can affect the compound's polarity and potential interactions with biological systems. This compound may exhibit interesting properties such as antimicrobial or herbicidal activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied.
Formula:C13H8ClFO3
InChI:InChI=1S/C13H8ClFO3/c14-9-3-1-2-8(12(9)13(17)18)7-4-5-11(16)10(15)6-7/h1-6,16H,(H,17,18)
InChI key:InChIKey=GTYNWJSBPONHKI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC=C1Cl)C2=CC(F)=C(O)C=C2
Synonyms:- [1,1′-Biphenyl]-2-carboxylic acid, 3-chloro-3′-fluoro-4′-hydroxy-
- 3-Chloro-3′-fluoro-4′-hydroxy[1,1′-biphenyl]-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.