CAS 1261890-32-7

1,2-Dihydro-5-(3-nitrophenyl)-2-oxo-4-pyridinecarboxylic acid

Description:

1,2-Dihydro-5-(3-nitrophenyl)-2-oxo-4-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a 3-nitrophenyl substituent, indicating the presence of a nitro group (-NO2) attached to a phenyl ring, which can influence its reactivity and solubility. The presence of the carboxylic acid functional group (-COOH) suggests that it can participate in acid-base reactions and may exhibit acidic properties. The compound's structure includes a dihydro form, indicating partial saturation of the ring, which can affect its stability and reactivity. Additionally, the oxo group (C=O) contributes to its potential as a chelating agent or in forming coordination complexes. Overall, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its specific properties, such as solubility, melting point, and reactivity, would require empirical data for precise characterization.

Formula: C₁₂H₈N₂O₅

InChI: InChI=1S/C12H8N2O5/c15-11-5-9(12(16)17)10(6-13-11)7-2-1-3-8(4-7)14(18)19/h1-6H,(H,13,15)(H,16,17)

InChI key: InChIKey=LKGCOBJXLCTOSX-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CNC(=O)C1)C2=CC(N(=O)=O)=CC=C2

Synonyms:

• 4-Pyridinecarboxylic acid, 1,2-dihydro-5-(3-nitrophenyl)-2-oxo-
• 1,2-Dihydro-5-(3-nitrophenyl)-2-oxo-4-pyridinecarboxylic acid