CAS 1261890-45-2

2′-Chloro-3-fluoro[1,1′-biphenyl]-4-ol

Description:

2′-Chloro-3-fluoro[1,1′-biphenyl]-4-ol, identified by its CAS number 1261890-45-2, is an organic compound characterized by the presence of a biphenyl structure with specific halogen and hydroxyl substitutions. The compound features a chlorine atom at the 2' position and a fluorine atom at the 3 position of one of the phenyl rings, along with a hydroxyl (-OH) group at the 4 position of the adjacent ring. This configuration contributes to its unique chemical properties, including potential reactivity and solubility characteristics influenced by the electronegative halogen atoms. The presence of the hydroxyl group suggests that the compound may exhibit hydrogen bonding capabilities, affecting its physical properties such as boiling and melting points. Additionally, the substitution pattern can influence its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. As with many halogenated compounds, it may also exhibit environmental persistence, necessitating careful handling and assessment of its ecological impact.

Formula: C₁₂H₈ClFO

InChI: InChI=1S/C12H8ClFO/c13-10-4-2-1-3-9(10)8-5-6-12(15)11(14)7-8/h1-7,15H

InChI key: InChIKey=NIKMRCJNZXNREL-UHFFFAOYSA-N

SMILES: ClC1=C(C=CC=C1)C2=CC(F)=C(O)C=C2

Synonyms:

• 2′-Chloro-3-fluoro[1,1′-biphenyl]-4-ol
• [1,1′-Biphenyl]-4-ol, 2′-chloro-3-fluoro-