CAS 1261890-46-3

3-(2-Fluoro-4-methoxyphenyl)-4-pyridinecarboxylic acid

Description:

3-(2-Fluoro-4-methoxyphenyl)-4-pyridinecarboxylic acid is an organic compound characterized by its unique molecular structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of a fluorine atom and a methoxy group on the phenyl ring contributes to its chemical properties, such as polarity and reactivity. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the methoxy group may enhance its lipophilicity. The fluorine substituent can influence the compound's electronic properties, potentially affecting its biological activity and interaction with other molecules. As a pyridine derivative, it may also participate in various chemical reactions typical of aromatic compounds, such as electrophilic substitution. Additionally, the compound's potential applications could span pharmaceuticals, agrochemicals, or materials science, depending on its specific biological activity and stability. Overall, its unique structural features make it a subject of interest in organic synthesis and medicinal chemistry.

Formula: C₁₃H₁₀FNO₃

InChI: InChI=1S/C13H10FNO3/c1-18-8-2-3-9(12(14)6-8)11-7-15-5-4-10(11)13(16)17/h2-7H,1H3,(H,16,17)

InChI key: InChIKey=YKDVRTYOYAKFSE-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CN=CC1)C2=C(F)C=C(OC)C=C2

Synonyms:

• 4-Pyridinecarboxylic acid, 3-(2-fluoro-4-methoxyphenyl)-
• 3-(2-Fluoro-4-methoxyphenyl)-4-pyridinecarboxylic acid