
CAS 1261890-50-9
:2-Amino-5-(3-fluoro-4-methoxyphenyl)-3-pyridinecarboxylic acid
Description:
2-Amino-5-(3-fluoro-4-methoxyphenyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and various functional groups. This substance features an amino group (-NH2) and a carboxylic acid group (-COOH), which contribute to its potential as a biologically active molecule. The presence of a fluorine atom and a methoxy group (-OCH3) on the phenyl ring enhances its chemical reactivity and may influence its pharmacological properties. The compound's molecular structure suggests it could participate in hydrogen bonding, making it soluble in polar solvents. Its unique arrangement of atoms may also allow for specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's CAS number, 1261890-50-9, serves as a unique identifier for regulatory and research purposes. Overall, this compound's characteristics position it as a candidate for further investigation in drug development and other chemical applications.
Formula:C13H11FN2O3
InChI:InChI=1S/C13H11FN2O3/c1-19-11-3-2-7(5-10(11)14)8-4-9(13(17)18)12(15)16-6-8/h2-6H,1H3,(H2,15,16)(H,17,18)
InChI key:InChIKey=BESQKRRAEMAIOF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1N)C2=CC(F)=C(OC)C=C2
Synonyms:- 2-Amino-5-(3-fluoro-4-methoxyphenyl)-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 2-amino-5-(3-fluoro-4-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.