CAS 1261890-86-1

3-(3-Chloro-5-fluorophenyl)-4-pyridinecarboxylic acid

Description:

3-(3-Chloro-5-fluorophenyl)-4-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of a chloro and a fluorine substituent on the phenyl ring contributes to its potential biological activity and chemical reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. The presence of halogen atoms can influence the compound's lipophilicity and metabolic stability, making it a candidate for further investigation in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be essential for understanding its behavior in various chemical environments. Overall, 3-(3-Chloro-5-fluorophenyl)-4-pyridinecarboxylic acid represents a class of compounds that may have significant implications in drug design and development.

Formula: C₁₂H₇ClFNO₂

InChI: InChI=1S/C12H7ClFNO2/c13-8-3-7(4-9(14)5-8)11-6-15-2-1-10(11)12(16)17/h1-6H,(H,16,17)

InChI key: InChIKey=HWPNLLVHWHJACB-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(C2=CC(Cl)=CC(F)=C2)=CN=CC1

Synonyms:

• 3-(3-Chloro-5-fluorophenyl)-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 3-(3-chloro-5-fluorophenyl)-