
CAS 1261891-01-3
:4-(3-Hydroxy-4-methoxyphenyl)-2-thiophenecarboxylic acid
Description:
4-(3-Hydroxy-4-methoxyphenyl)-2-thiophenecarboxylic acid, identified by its CAS number 1261891-01-3, is an organic compound characterized by its complex structure, which includes a thiophene ring and a phenolic moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a hydroxyl group and a methoxy group on the phenyl ring enhances its potential for hydrogen bonding and influences its solubility in various solvents. The thiophene ring adds to the compound's aromatic character, which can affect its electronic properties and reactivity. This substance may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of compounds with potential therapeutic applications. Its unique structural features suggest that it could participate in various chemical reactions, including esterification and electrophilic substitution. Overall, the compound's characteristics make it a subject of interest in both synthetic organic chemistry and medicinal chemistry.
Formula:C12H10O4S
InChI:InChI=1S/C12H10O4S/c1-16-10-3-2-7(4-9(10)13)8-5-11(12(14)15)17-6-8/h2-6,13H,1H3,(H,14,15)
InChI key:InChIKey=YPLSCQSUUQOXKC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CS1)C2=CC(O)=C(OC)C=C2
Synonyms:- 2-Thiophenecarboxylic acid, 4-(3-hydroxy-4-methoxyphenyl)-
- 4-(3-Hydroxy-4-methoxyphenyl)-2-thiophenecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.