CAS 1261891-19-3

5-(4-Chloro-3-cyanophenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid

Description:

5-(4-Chloro-3-cyanophenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and various functional groups. The presence of a chloro group and a cyano group on the phenyl ring contributes to its reactivity and potential biological activity. This compound is likely to exhibit properties such as moderate solubility in organic solvents and varying solubility in water, influenced by the polar functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine and carboxylic acid moieties, which are often associated with bioactive compounds. Additionally, the compound may exhibit specific interactions with biological targets, making it of interest for further research in drug discovery. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.

Formula: C₁₃H₇ClN₂O₃

InChI: InChI=1S/C13H7ClN2O3/c14-11-2-1-7(3-8(11)5-15)10-6-16-12(17)4-9(10)13(18)19/h1-4,6H,(H,16,17)(H,18,19)

InChI key: InChIKey=OKLVQDPRMWCWJN-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CNC(=O)C1)C2=CC(C#N)=C(Cl)C=C2

Synonyms:

• 5-(4-Chloro-3-cyanophenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 5-(4-chloro-3-cyanophenyl)-1,2-dihydro-2-oxo-