CAS 1261891-59-1

2-Methyl-3′-nitro[1,1′-biphenyl]-3-carboxylic acid

Description:

2-Methyl-3′-nitro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. The compound also features a nitro group (-NO2) and a methyl group (-CH3) attached to the biphenyl framework, which can influence its reactivity and solubility. The nitro group is known for its electron-withdrawing properties, which can affect the compound's acidity and overall chemical behavior. This compound may exhibit various physical properties such as melting and boiling points, which are influenced by its molecular structure and intermolecular interactions. Additionally, it may have applications in organic synthesis, pharmaceuticals, or as an intermediate in chemical manufacturing, although specific applications would depend on further research and development. Safety data and handling precautions should be considered due to the presence of the nitro group, which can be associated with toxicity and environmental concerns.

Formula: C₁₄H₁₁NO₄

InChI: InChI=1S/C14H11NO4/c1-9-12(6-3-7-13(9)14(16)17)10-4-2-5-11(8-10)15(18)19/h2-8H,1H3,(H,16,17)

InChI key: InChIKey=VVAXRPVAMDOURM-UHFFFAOYSA-N

SMILES: CC1=C(C=CC=C1C(O)=O)C2=CC(N(=O)=O)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 2-methyl-3′-nitro-
• 2-Methyl-3′-nitro[1,1′-biphenyl]-3-carboxylic acid