
CAS 1261891-60-4
:N-(4′-Cyano-3′-hydroxy[1,1′-biphenyl]-3-yl)acetamide
Description:
N-(4′-Cyano-3′-hydroxy[1,1′-biphenyl]-3-yl)acetamide, with the CAS number 1261891-60-4, is an organic compound characterized by its biphenyl structure, which features a cyano group and a hydroxy group at specific positions on the aromatic rings. This compound typically exhibits properties associated with both aromatic and amide functionalities, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the cyano group contributes to its polarity and may influence its reactivity, particularly in nucleophilic substitution reactions. The hydroxy group can participate in hydrogen bonding, affecting its physical properties such as melting point and boiling point. Additionally, the acetamide moiety suggests potential applications in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of biologically active compounds. Overall, this compound's unique structural features may lend it interesting properties for research and application in various chemical contexts.
Formula:C15H12N2O2
InChI:InChI=1S/C15H12N2O2/c1-10(18)17-14-4-2-3-11(7-14)12-5-6-13(9-16)15(19)8-12/h2-8,19H,1H3,(H,17,18)
InChI key:InChIKey=FLEZYCZKGRIUDO-UHFFFAOYSA-N
SMILES:OC=1C=C(C=CC1C#N)C2=CC(NC(C)=O)=CC=C2
Synonyms:- Acetamide, N-(4′-cyano-3′-hydroxy[1,1′-biphenyl]-3-yl)-
- N-(4′-Cyano-3′-hydroxy[1,1′-biphenyl]-3-yl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.