CAS 1261891-65-9

3-Hydroxy-3′-nitro[1,1′-biphenyl]-4-carboxylic acid

Description:

3-Hydroxy-3′-nitro[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by the presence of a biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) and a nitro group (-NO2) attached to the biphenyl framework, as well as a carboxylic acid group (-COOH) at the para position relative to the hydroxyl group. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The hydroxyl group can participate in hydrogen bonding, enhancing solubility in polar solvents, while the nitro group can influence the compound's electronic properties and reactivity. Additionally, the carboxylic acid group can undergo typical acid-base reactions. Overall, the compound's unique structure and functional groups make it of interest for further study in organic synthesis and potential applications in drug development or as a chemical intermediate.

Formula: C₁₃H₉NO₅

InChI: InChI=1S/C13H9NO5/c15-12-7-9(4-5-11(12)13(16)17)8-2-1-3-10(6-8)14(18)19/h1-7,15H,(H,16,17)

InChI key: InChIKey=NHFUIUSOSAKBDN-UHFFFAOYSA-N

SMILES: OC=1C=C(C=CC1C(O)=O)C2=CC(N(=O)=O)=CC=C2

Synonyms:

• 3-Hydroxy-3′-nitro[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 3-hydroxy-3′-nitro-