CymitQuimica logo

CAS 1261891-88-6

:

5-[3-Fluoro-5-(methoxycarbonyl)phenyl]-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid

Description:
5-[3-Fluoro-5-(methoxycarbonyl)phenyl]-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with a fluorine atom and a methoxycarbonyl group. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity. The methoxycarbonyl group contributes to the compound's reactivity and solubility properties, making it potentially useful in various chemical reactions or as a precursor in synthetic pathways. The dihydro-6-oxo structure indicates that the compound may exhibit keto-enol tautomerism, which can affect its stability and reactivity. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique functional groups that can interact with biological targets. Its specific properties, such as melting point, solubility, and reactivity, would need to be determined through experimental studies for practical applications.
Formula:C14H10FNO5
InChI:InChI=1S/C14H10FNO5/c1-21-14(20)8-2-7(3-10(15)4-8)11-5-9(13(18)19)6-16-12(11)17/h2-6H,1H3,(H,16,17)(H,18,19)
InChI key:InChIKey=NEHGGVCVIFWNFM-UHFFFAOYSA-N
SMILES:O=C1C(C2=CC(C(OC)=O)=CC(F)=C2)=CC(C(O)=O)=CN1
Synonyms:
  • 3-Pyridinecarboxylic acid, 5-[3-fluoro-5-(methoxycarbonyl)phenyl]-1,6-dihydro-6-oxo-
  • 5-[3-Fluoro-5-(methoxycarbonyl)phenyl]-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.