CAS 1261892-15-2

2-Hydroxy-4-(2-naphthalenyl)benzaldehyde

Description:

2-Hydroxy-4-(2-naphthalenyl)benzaldehyde, also known as a naphthalene derivative, is an organic compound characterized by the presence of both a hydroxyl group (-OH) and an aldehyde group (-CHO) attached to a benzene ring. This compound features a naphthalene moiety, which contributes to its aromatic properties and potential for π-π stacking interactions. The hydroxyl group imparts polarity, enhancing its solubility in polar solvents, while the aldehyde group can participate in various chemical reactions, including condensation and oxidation. The compound may exhibit fluorescence due to its conjugated system, making it of interest in materials science and organic synthesis. Its structural features suggest potential applications in organic electronics, dyes, and as a building block in the synthesis of more complex molecules. Additionally, the presence of multiple aromatic rings may influence its stability and reactivity, making it a subject of study in fields such as medicinal chemistry and materials science. Safety data and handling precautions should be considered, as with any chemical substance.

Formula: C₁₇H₁₂O₂

InChI: InChI=1S/C17H12O2/c18-11-16-8-7-15(10-17(16)19)14-6-5-12-3-1-2-4-13(12)9-14/h1-11,19H

InChI key: InChIKey=DSMPJOHQOPVPOQ-UHFFFAOYSA-N

SMILES: OC=1C=C(C2=CC3=C(C=C2)C=CC=C3)C=CC1C=O

Synonyms:

• Benzaldehyde, 2-hydroxy-4-(2-naphthalenyl)-
• 2-Hydroxy-4-(2-naphthalenyl)benzaldehyde