CAS 1261892-16-3

Methyl 4-(3-formyl-4-hydroxyphenyl)-2-thiophenecarboxylate

Description:

Methyl 4-(3-formyl-4-hydroxyphenyl)-2-thiophenecarboxylate, identified by its CAS number 1261892-16-3, is an organic compound characterized by its complex structure that includes a thiophene ring, a carboxylate group, and a phenolic moiety with an aldehyde functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential UV absorption and reactivity due to the presence of the aldehyde and hydroxyl groups. It may participate in various chemical reactions, including condensation and esterification, making it useful in synthetic organic chemistry. The presence of the thiophene ring suggests potential applications in materials science, particularly in organic electronics or as a building block for more complex molecules. Additionally, the compound's structural features may confer biological activity, warranting investigation for potential pharmaceutical applications. Overall, its unique combination of functional groups and heterocyclic structure makes it a compound of interest in both academic and industrial research settings.

Formula: C₁₃H₁₀O₄S

InChI: InChI=1S/C13H10O4S/c1-17-13(16)12-5-10(7-18-12)8-2-3-11(15)9(4-8)6-14/h2-7,15H,1H3

InChI key: InChIKey=WZZLSSULPUHEAD-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC(=CS1)C2=CC(C=O)=C(O)C=C2

Synonyms:

• Methyl 4-(3-formyl-4-hydroxyphenyl)-2-thiophenecarboxylate
• 2-Thiophenecarboxylic acid, 4-(3-formyl-4-hydroxyphenyl)-, methyl ester