CymitQuimica logo

CAS 1261892-33-4

:

5-[4-(Ethoxycarbonyl)phenyl]-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid

Description:
5-[4-(Ethoxycarbonyl)phenyl]-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid, identified by its CAS number 1261892-33-4, is a chemical compound that features a pyridine ring substituted with various functional groups. This compound typically exhibits characteristics common to pyridine derivatives, such as moderate polarity and the ability to engage in hydrogen bonding due to the presence of carboxylic acid and carbonyl groups. The ethoxycarbonyl group contributes to its lipophilicity, potentially enhancing its solubility in organic solvents. The presence of the phenyl group may impart aromatic stability and influence the compound's reactivity and interaction with biological systems. Additionally, the dihydro-6-oxo structure suggests that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features and potential biological activity. However, specific properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise characterization.
Formula:C15H13NO5
InChI:InChI=1S/C15H13NO5/c1-2-21-15(20)10-5-3-9(4-6-10)12-7-11(14(18)19)8-16-13(12)17/h3-8H,2H2,1H3,(H,16,17)(H,18,19)
InChI key:InChIKey=XDQAWNAHQMUQFR-UHFFFAOYSA-N
SMILES:O=C1C(=CC(C(O)=O)=CN1)C2=CC=C(C(OCC)=O)C=C2
Synonyms:
  • 5-[4-(Ethoxycarbonyl)phenyl]-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 5-[4-(ethoxycarbonyl)phenyl]-1,6-dihydro-6-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.