
CAS 1261892-62-9
:5-Chloro-3′-formyl[1,1′-biphenyl]-3-carboxylic acid
Description:
5-Chloro-3′-formyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 5-position and a formyl group at the 3′-position contributes to its reactivity and potential applications in organic synthesis. The carboxylic acid functional group at the 3-position enhances its acidity and solubility in polar solvents, making it useful in various chemical reactions, including esterification and amidation. This compound may exhibit biological activity due to its structural features, which can interact with biological targets. Its molecular structure allows for potential applications in pharmaceuticals, agrochemicals, or as intermediates in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns. Overall, 5-Chloro-3′-formyl[1,1′-biphenyl]-3-carboxylic acid is a versatile compound with significant implications in chemical research and industry.
Formula:C14H9ClO3
InChI:InChI=1S/C14H9ClO3/c15-13-6-11(5-12(7-13)14(17)18)10-3-1-2-9(4-10)8-16/h1-8H,(H,17,18)
InChI key:InChIKey=KDBQVBVNXDZCMS-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(Cl)C1)C2=CC(C=O)=CC=C2
Synonyms:- 5-Chloro-3′-formyl[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 5-chloro-3′-formyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.