CAS 1261892-79-8

2′-Chloro-5′-methoxy-5-nitro[1,1′-biphenyl]-3-carboxylic acid

Description:

2′-Chloro-5′-methoxy-5-nitro[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its complex biphenyl structure, which includes a carboxylic acid functional group, a nitro group, a methoxy group, and a chlorine substituent. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for electrophilic substitution reactions. The presence of the nitro group suggests it may have electron-withdrawing characteristics, influencing its reactivity and solubility in various solvents. The methoxy group can enhance solubility in organic solvents and may also affect the compound's overall polarity. Additionally, the chlorine atom can introduce further reactivity and influence the compound's biological activity. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific interactions and behaviors of this compound would depend on its molecular structure and the functional groups present, making it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₄H₁₀ClNO₅

InChI: InChI=1S/C14H10ClNO5/c1-21-11-2-3-13(15)12(7-11)8-4-9(14(17)18)6-10(5-8)16(19)20/h2-7H,1H3,(H,17,18)

InChI key: InChIKey=HAEVOZUCOYDDGS-UHFFFAOYSA-N

SMILES: ClC=1C(=CC(OC)=CC1)C2=CC(C(O)=O)=CC(N(=O)=O)=C2

Synonyms:

• 2′-Chloro-5′-methoxy-5-nitro[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 2′-chloro-5′-methoxy-5-nitro-

3-(2-Chloro-5-methoxyphenyl)-5-nitrobenzoic acid

CAS: 1261892-79-8

Formula: C₁₄H₁₀ClNO₅

Molecular weight: 307.6859

Ref: IN-DA000S2V