
CAS 1261892-82-3
:4′-(Hydroxymethyl)-2-methyl[1,1′-biphenyl]-3-carboxylic acid
Description:
4′-(Hydroxymethyl)-2-methyl[1,1′-biphenyl]-3-carboxylic acid, identified by its CAS number 1261892-82-3, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxymethyl group (-CH2OH) and a carboxylic acid group (-COOH) attached to the biphenyl framework, contributing to its potential reactivity and solubility in polar solvents. The presence of the methyl group at the 2-position of the biphenyl enhances its hydrophobic characteristics, while the carboxylic acid group provides acidic properties, allowing for potential interactions in various chemical environments. This compound may exhibit biological activity, making it of interest in pharmaceutical and materials science research. Its structural features suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature.
Formula:C15H14O3
InChI:InChI=1S/C15H14O3/c1-10-13(3-2-4-14(10)15(17)18)12-7-5-11(9-16)6-8-12/h2-8,16H,9H2,1H3,(H,17,18)
InChI key:InChIKey=DHLVXRWTRLZZSE-UHFFFAOYSA-N
SMILES:CC1=C(C=CC=C1C(O)=O)C2=CC=C(CO)C=C2
Synonyms:- [1,1′-Biphenyl]-3-carboxylic acid, 4′-(hydroxymethyl)-2-methyl-
- 4′-(Hydroxymethyl)-2-methyl[1,1′-biphenyl]-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.