CAS 1261892-86-7
:2-Fluoro-4′-methoxy[1,1′-biphenyl]-4-carboxylic acid
Description:
2-Fluoro-4′-methoxy[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the second position and a methoxy group at the para position of one of the phenyl rings contributes to its unique chemical properties, including potential variations in polarity and reactivity. The carboxylic acid functional group at the fourth position enhances its acidity and solubility in polar solvents. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry and material science. Its molecular interactions can be influenced by the electron-withdrawing nature of the fluoro group and the electron-donating characteristics of the methoxy group, which can affect its overall stability and reactivity. Additionally, the compound's specific stereochemistry and substituent positions can play a crucial role in determining its physical properties, such as melting point, boiling point, and solubility.
Formula:C14H11FO3
InChI:InChI=1S/C14H11FO3/c1-18-11-5-2-9(3-6-11)12-7-4-10(14(16)17)8-13(12)15/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=QKIRDCPNZXELCV-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(C(O)=O)=C1)C2=CC=C(OC)C=C2
Synonyms:- [1,1′-Biphenyl]-4-carboxylic acid, 2-fluoro-4′-methoxy-
- 2-Fluoro-4′-methoxy[1,1′-biphenyl]-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
