CAS 1261892-99-2

2′,4′-Dichloro-2-fluoro[1,1′-biphenyl]-4-carboxylic acid

Description:

2′,4′-Dichloro-2-fluoro[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two chlorine atoms and one fluorine atom on the biphenyl framework contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The carboxylic acid functional group (-COOH) at the para position of one of the phenyl rings imparts acidic characteristics, allowing for potential interactions in various chemical reactions and biological systems. This compound may exhibit interesting reactivity due to the electron-withdrawing effects of the halogen substituents, which can influence its acidity and reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of multiple halogens can enhance its stability and alter its solubility in different solvents. Overall, 2′,4′-Dichloro-2-fluoro[1,1′-biphenyl]-4-carboxylic acid is a compound of interest in fields such as medicinal chemistry and materials science.

Formula: C₁₃H₇Cl₂FO₂

InChI: InChI=1S/C13H7Cl2FO2/c14-8-2-4-9(11(15)6-8)10-3-1-7(13(17)18)5-12(10)16/h1-6H,(H,17,18)

InChI key: InChIKey=BAPKYSVYIIQFEI-UHFFFAOYSA-N

SMILES: FC1=C(C=CC(C(O)=O)=C1)C2=C(Cl)C=C(Cl)C=C2

Synonyms:

• 2′,4′-Dichloro-2-fluoro[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 2′,4′-dichloro-2-fluoro-