CAS 1261893-04-2
:2,3′-Difluoro-4′-methyl[1,1′-biphenyl]-4-carboxylic acid
Description:
2,3′-Difluoro-4′-methyl[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2 and 3 positions of one phenyl ring, along with a methyl group at the 4′ position and a carboxylic acid functional group at the 4 position of the other ring, contributes to its unique chemical properties. This compound is likely to exhibit polar characteristics due to the carboxylic acid group, which can participate in hydrogen bonding, influencing its solubility in various solvents. The fluorine substituents can enhance the compound's stability and alter its reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the presence of the methyl group may affect the steric hindrance and electronic properties of the molecule, potentially influencing its biological activity and interactions with other chemical entities.
Formula:C14H10F2O2
InChI:InChI=1S/C14H10F2O2/c1-8-2-3-9(6-12(8)15)11-5-4-10(14(17)18)7-13(11)16/h2-7H,1H3,(H,17,18)
InChI key:InChIKey=WHEWBRDYJWPYHK-UHFFFAOYSA-N
SMILES:FC1=C(C2=CC(F)=C(C)C=C2)C=CC(C(O)=O)=C1
Synonyms:- 2,3′-Difluoro-4′-methyl[1,1′-biphenyl]-4-carboxylic acid
- [1,1′-Biphenyl]-4-carboxylic acid, 2,3′-difluoro-4′-methyl-
- 3-Fluoro-4-(3-fluoro-4-Methylphenyl)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
