CymitQuimica logo

CAS 1261893-05-3

:

4-(1,6-Dihydro-6-oxo-2-pyridinyl)-N-ethyl-2-fluorobenzamide

Description:
4-(1,6-Dihydro-6-oxo-2-pyridinyl)-N-ethyl-2-fluorobenzamide, identified by its CAS number 1261893-05-3, is a chemical compound that features a pyridine ring and a fluorobenzamide moiety. This substance is characterized by its unique structural components, which include a dihydropyridine derivative that contributes to its potential biological activity. The presence of the ethyl group and the fluorine atom enhances its lipophilicity, potentially influencing its pharmacokinetic properties. The compound may exhibit various interactions due to the functional groups present, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which it is studied. As with many compounds in this class, it may also be evaluated for its efficacy and safety in biological systems, which is crucial for any potential therapeutic applications.
Formula:C14H13FN2O2
InChI:InChI=1S/C14H13FN2O2/c1-2-16-14(19)10-7-6-9(8-11(10)15)12-4-3-5-13(18)17-12/h3-8H,2H2,1H3,(H,16,19)(H,17,18)
InChI key:InChIKey=WOJBDEOWTIWYSE-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1C(NCC)=O)C=2NC(=O)C=CC2
Synonyms:
  • Benzamide, 4-(1,6-dihydro-6-oxo-2-pyridinyl)-N-ethyl-2-fluoro-
  • 4-(1,6-Dihydro-6-oxo-2-pyridinyl)-N-ethyl-2-fluorobenzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.