CAS 1261893-14-4

2′-Fluoro-5-methyl[1,1′-biphenyl]-3-ol

Description:

2′-Fluoro-5-methyl[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 3-position contributes to its classification as a phenolic compound, imparting properties such as potential acidity and the ability to participate in hydrogen bonding. The fluorine atom at the 2′ position and the methyl group at the 5 position introduce unique electronic and steric effects, which can influence the compound's reactivity and solubility. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry and materials science. Additionally, its molecular interactions can be studied for applications in various fields, including pharmaceuticals and agrochemicals. As with many organic compounds, its stability, reactivity, and potential applications can be significantly affected by the specific functional groups and their positions within the molecular framework.

Formula: C₁₃H₁₁FO

InChI: InChI=1S/C13H11FO/c1-9-6-10(8-11(15)7-9)12-4-2-3-5-13(12)14/h2-8,15H,1H3

InChI key: InChIKey=HMXIOBAEYHQKJI-UHFFFAOYSA-N

SMILES: FC1=C(C=CC=C1)C2=CC(C)=CC(O)=C2

Synonyms:

• [1,1′-Biphenyl]-3-ol, 2′-fluoro-5-methyl-
• 2′-Fluoro-5-methyl[1,1′-biphenyl]-3-ol