CAS 1261893-15-5

4-Methyl 3,3′-difluoro[1,1′-biphenyl]-4,4′-dicarboxylate

Description:

4-Methyl 3,3′-difluoro[1,1′-biphenyl]-4,4′-dicarboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two carboxylate groups (dicarboxylate) indicates that it has potential for forming salts or esters, enhancing its reactivity and solubility in various solvents. The difluoro substituents introduce significant electronegativity, which can influence the compound's electronic properties and reactivity, potentially making it useful in various chemical applications, including pharmaceuticals and agrochemicals. The methyl group adds to the steric and electronic characteristics of the molecule, potentially affecting its interactions with other substances. This compound may exhibit interesting thermal and chemical stability due to its structural features. Additionally, its specific CAS number allows for precise identification in chemical databases, facilitating research and application in various fields of chemistry. Overall, the unique combination of functional groups and substituents in this compound contributes to its potential utility in synthetic chemistry and material science.

Formula: C₁₅H₁₀F₂O₄

InChI: InChI=1S/C15H10F2O4/c1-21-15(20)11-5-3-9(7-13(11)17)8-2-4-10(14(18)19)12(16)6-8/h2-7H,1H3,(H,18,19)

InChI key: InChIKey=PVRIHXUNAVSIBY-UHFFFAOYSA-N

SMILES: FC=1C=C(C=CC1C(OC)=O)C2=CC(F)=C(C(O)=O)C=C2

Synonyms:

• 4-Methyl 3,3′-difluoro[1,1′-biphenyl]-4,4′-dicarboxylate
• [1,1′-Biphenyl]-4,4′-dicarboxylic acid, 3,3′-difluoro-, 4-methyl ester