
CAS 1261893-20-2
:[1,1′-Biphenyl]-2-carboxylic acid, 3′-fluoro-4′-methyl-5-nitro-
Description:
[1,1′-Biphenyl]-2-carboxylic acid, 3′-fluoro-4′-methyl-5-nitro- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) at the 2-position indicates its acidic properties, allowing it to participate in acid-base reactions. The compound also features a fluoro group at the 3′ position, a methyl group at the 4′ position, and a nitro group (-NO2) at the 5-position of one of the phenyl rings, contributing to its overall reactivity and potential applications in pharmaceuticals or agrochemicals. The presence of these substituents can influence the compound's polarity, solubility, and biological activity. Additionally, the nitro group is known for its electron-withdrawing properties, which can affect the compound's reactivity in electrophilic aromatic substitution reactions. Overall, this compound exemplifies the complexity and diversity of substituted aromatic acids in organic chemistry.
Formula:C14H10FNO4
InChI:InChI=1S/C14H10FNO4/c1-8-2-3-9(6-13(8)15)12-7-10(16(19)20)4-5-11(12)14(17)18/h2-7H,1H3,(H,17,18)
InChI key:InChIKey=WZFRICDWSQDEHH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=C(N(=O)=O)C=C1)C2=CC(F)=C(C)C=C2
Synonyms:- 2-(3-Fluoro-4-methylphenyl)-4-nitrobenzoic acid
- [1,1′-Biphenyl]-2-carboxylic acid, 3′-fluoro-4′-methyl-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.