CymitQuimica logo

CAS 1261893-39-3

:

4-Chloro-3′-(methylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid

Description:
4-Chloro-3′-(methylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. The compound also features a chloro substituent at the 4-position and a methylsulfonyl group (-SO2CH3) at the 3′ position of the biphenyl, which can influence its reactivity and solubility. This compound may exhibit various properties such as moderate to high polarity due to the functional groups, and it may participate in hydrogen bonding due to the carboxylic acid. Its unique structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups can enhance biological activity or selectivity. Additionally, the presence of chlorine and sulfonyl groups may impart specific electronic properties, making it of interest in materials science and organic synthesis.
Formula:C14H11ClO4S
InChI:InChI=1S/C14H11ClO4S/c1-20(18,19)11-4-2-3-9(7-11)10-5-6-13(15)12(8-10)14(16)17/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=ASZUABYRNHGSOM-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1Cl)C2=CC(S(C)(=O)=O)=CC=C2
Synonyms:
  • 4-Chloro-3′-(methylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 4-chloro-3′-(methylsulfonyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.