
CAS 1261893-57-5
:3-(5-Formyl-2-thienyl)-5-methoxybenzoic acid
Description:
3-(5-Formyl-2-thienyl)-5-methoxybenzoic acid is an organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a methoxy group and a thienyl group that features an aldehyde functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the aldehyde. The methoxy group can influence its solubility and polarity, making it more soluble in organic solvents. The thienyl ring contributes to its electronic properties, potentially allowing for interesting interactions in biological systems or materials science applications. Additionally, the presence of the carboxylic acid group suggests that it can participate in acid-base reactions and may form salts or esters. Overall, this compound's unique structure may lend itself to various applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis.
Formula:C13H10O4S
InChI:InChI=1S/C13H10O4S/c1-17-10-5-8(4-9(6-10)13(15)16)12-3-2-11(7-14)18-12/h2-7H,1H3,(H,15,16)
InChI key:InChIKey=XHCZDFBEGGNBNX-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(OC)C1)C=2SC(C=O)=CC2
Synonyms:- Benzoic acid, 3-(5-formyl-2-thienyl)-5-methoxy-
- 3-(5-Formyl-2-thienyl)-5-methoxybenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.