CAS 1261893-62-2

3′-Fluoro[1,1′-biphenyl]-2,4′-dicarboxylic acid

Description:

3′-Fluoro[1,1′-biphenyl]-2,4′-dicarboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the 3′ position and carboxylic acid groups at the 2 and 4′ positions significantly influences its chemical properties. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid groups, while the biphenyl moiety may contribute to hydrophobic characteristics. The fluorine substituent can enhance the compound's stability and alter its electronic properties, potentially affecting its reactivity and interactions with other molecules. Additionally, the dicarboxylic acid functionality suggests potential for forming hydrogen bonds, which can be important in biological systems or in materials science applications. Overall, this compound may have applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, owing to its unique structural features and functional groups.

Formula: C₁₄H₉FO₄

InChI: InChI=1S/C14H9FO4/c15-12-7-8(5-6-11(12)14(18)19)9-3-1-2-4-10(9)13(16)17/h1-7H,(H,16,17)(H,18,19)

InChI key: InChIKey=YNOGECZNEPCVQJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC=C1)C2=CC(F)=C(C(O)=O)C=C2

Synonyms:

• [1,1′-Biphenyl]-2,4′-dicarboxylic acid, 3′-fluoro-
• 3′-Fluoro[1,1′-biphenyl]-2,4′-dicarboxylic acid

2-(4-Carboxy-3-fluorophenyl)benzoic acid

CAS: 1261893-62-2

Formula: C₁₄H₉FO₄

Molecular weight: 260.2173

Ref: IN-DA000S44