CAS 1261893-68-8

3′-(Methylsulfonyl)[1,1′-biphenyl]-2-carboxylic acid

Description:

3′-(Methylsulfonyl)[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methylsulfonyl group (-SO2CH3) at the 3′ position enhances its solubility in polar solvents and may influence its reactivity and biological activity. The carboxylic acid functional group (-COOH) at the 2-position contributes to its acidity and potential for forming hydrogen bonds, which can affect its interactions in biological systems. This compound may exhibit properties such as being a potential pharmaceutical intermediate or a building block in organic synthesis. Its molecular structure suggests it could participate in various chemical reactions, including esterification and amidation. Additionally, the presence of both electron-donating and electron-withdrawing groups may influence its electronic properties, making it of interest in studies related to drug design and material science. As with any chemical substance, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₄H₁₂O₄S

InChI: InChI=1S/C14H12O4S/c1-19(17,18)11-6-4-5-10(9-11)12-7-2-3-8-13(12)14(15)16/h2-9H,1H3,(H,15,16)

InChI key: InChIKey=CRFSKLQGZLHHFH-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC=C1)C2=CC(S(C)(=O)=O)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-2-carboxylic acid, 3′-(methylsulfonyl)-
• 3′-(Methylsulfonyl)[1,1′-biphenyl]-2-carboxylic acid