
CAS 1261893-79-1
:4′-Methoxy-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxylic acid
Description:
4′-Methoxy-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methoxy group (-OCH3) at the para position and a trifluoromethyl group (-CF3) at the meta position on one of the phenyl rings significantly influences its chemical properties, including its polarity and reactivity. The carboxylic acid functional group (-COOH) at the para position of the other phenyl ring contributes to its acidity and potential for hydrogen bonding. This compound is likely to exhibit moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the biphenyl structure and the bulky trifluoromethyl group. Its unique combination of functional groups may impart interesting biological or pharmacological activities, making it a subject of interest in medicinal chemistry and materials science.
Formula:C15H11F3O3
InChI:InChI=1S/C15H11F3O3/c1-21-13-7-6-11(8-12(13)15(16,17)18)9-2-4-10(5-3-9)14(19)20/h2-8H,1H3,(H,19,20)
InChI key:InChIKey=YDEMXTQURLJFRX-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(OC)C=CC(=C1)C2=CC=C(C(O)=O)C=C2
Synonyms:- [1,1′-Biphenyl]-4-carboxylic acid, 4′-methoxy-3′-(trifluoromethyl)-
- 4′-Methoxy-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.