CAS 1261893-86-0

4′-Acetyl-4-methyl[1,1′-biphenyl]-2-carboxylic acid

Description:

4′-Acetyl-4-methyl[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features an acetyl group and a carboxylic acid functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl group on the biphenyl framework influences its steric and electronic properties, which can affect its solubility and interaction with other molecules. As a carboxylic acid, it exhibits acidic behavior, capable of donating protons in solution. The compound may be utilized in various chemical reactions, including esterification and acylation, and could serve as an intermediate in the synthesis of more complex organic molecules. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound is of interest in the fields of organic chemistry and materials science.

Formula: C₁₆H₁₄O₃

InChI: InChI=1S/C16H14O3/c1-10-3-8-14(15(9-10)16(18)19)13-6-4-12(5-7-13)11(2)17/h3-9H,1-2H3,(H,18,19)

InChI key: InChIKey=BTJYTUZWCWJRQK-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC(C)=C1)C2=CC=C(C(C)=O)C=C2

Synonyms:

• [1,1′-Biphenyl]-2-carboxylic acid, 4′-acetyl-4-methyl-
• 4′-Acetyl-4-methyl[1,1′-biphenyl]-2-carboxylic acid