CAS 1261894-07-8

3′-Chloro-5′-fluoro[1,1′-biphenyl]-3-ol

Description:

3′-Chloro-5′-fluoro[1,1′-biphenyl]-3-ol is an organic compound characterized by the presence of a biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) at the 3-position of one of the phenyl rings, contributing to its classification as a phenolic compound. The presence of chlorine and fluorine substituents at the 3′ and 5′ positions, respectively, introduces unique electronic and steric properties, potentially influencing its reactivity and interactions in various chemical environments. The chlorine atom may enhance lipophilicity, while the fluorine atom can impart stability and alter the compound's polarity. Such modifications can affect the compound's biological activity, making it of interest in fields such as medicinal chemistry and materials science. Additionally, the compound's specific structural features may lead to unique applications in pharmaceuticals or as intermediates in organic synthesis. As with many halogenated compounds, considerations regarding environmental impact and toxicity are essential for its handling and use.

Formula: C₁₂H₈ClFO

InChI: InChI=1S/C12H8ClFO/c13-10-4-9(5-11(14)7-10)8-2-1-3-12(15)6-8/h1-7,15H

InChI key: InChIKey=LZCGRJVDIBOLSF-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=C(F)C1)C2=CC(O)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-ol, 3′-chloro-5′-fluoro-
• 3′-Chloro-5′-fluoro[1,1′-biphenyl]-3-ol