CymitQuimica logo

CAS 1261894-11-4

:

2′,4′,6′-Trifluoro[1,1′-biphenyl]-2-ol

Description:
2′,4′,6′-Trifluoro[1,1′-biphenyl]-2-ol is a chemical compound characterized by its biphenyl structure, where a hydroxyl group (-OH) is attached to one of the phenyl rings, and three fluorine atoms are substituted at the 2′, 4′, and 6′ positions of the other phenyl ring. This substitution pattern significantly influences the compound's physical and chemical properties, including its polarity, solubility, and reactivity. The presence of fluorine atoms typically enhances the compound's stability and can impart unique electronic properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. The hydroxyl group contributes to its potential as a hydrogen bond donor, affecting its interactions with other molecules. Additionally, the compound's molecular structure suggests it may exhibit interesting thermal and spectral characteristics, which can be explored through techniques such as NMR and IR spectroscopy. Overall, 2′,4′,6′-Trifluoro[1,1′-biphenyl]-2-ol represents a versatile compound with potential utility in diverse chemical research and applications.
Formula:C12H7F3O
InChI:InChI=1S/C12H7F3O/c13-7-5-9(14)12(10(15)6-7)8-3-1-2-4-11(8)16/h1-6,16H
InChI key:InChIKey=GDIMBVYJJBXXLX-UHFFFAOYSA-N
SMILES:FC1=C(C(F)=CC(F)=C1)C2=C(O)C=CC=C2
Synonyms:
  • 2′,4′,6′-Trifluoro[1,1′-biphenyl]-2-ol
  • [1,1′-Biphenyl]-2-ol, 2′,4′,6′-trifluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.