
CAS 1261894-27-2
:5-Fluoro-4′-(methylsulfonyl)[1,1′-biphenyl]-3-ol
Description:
5-Fluoro-4′-(methylsulfonyl)[1,1′-biphenyl]-3-ol is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the 5-position and a methylsulfonyl group at the 4′-position contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The hydroxyl group (-OH) at the 3-position enhances its polarity, making it more soluble in polar solvents. This compound may exhibit biological activity, potentially influencing its application in pharmaceuticals or agrochemicals. Its molecular structure suggests that it could participate in hydrogen bonding due to the hydroxyl group, which may affect its interaction with biological targets. Additionally, the presence of the methylsulfonyl group can enhance metabolic stability and influence lipophilicity. Overall, 5-Fluoro-4′-(methylsulfonyl)[1,1′-biphenyl]-3-ol is a compound of interest in medicinal chemistry and material science due to its distinctive functional groups and structural features.
Formula:C13H11FO3S
InChI:InChI=1S/C13H11FO3S/c1-18(16,17)13-4-2-9(3-5-13)10-6-11(14)8-12(15)7-10/h2-8,15H,1H3
InChI key:InChIKey=ZOTQLFJDRWFHCS-UHFFFAOYSA-N
SMILES:FC=1C=C(C2=CC=C(S(C)(=O)=O)C=C2)C=C(O)C1
Synonyms:- 5-Fluoro-4′-(methylsulfonyl)[1,1′-biphenyl]-3-ol
- [1,1′-Biphenyl]-3-ol, 5-fluoro-4′-(methylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.