CymitQuimica logo

CAS 1261894-34-1

:

3′-Fluoro-4,4′-dimethyl[1,1′-biphenyl]-3-ol

Description:
3′-Fluoro-4,4′-dimethyl[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 3-position of one of the phenyl rings contributes to its classification as an alcohol. The compound also features a fluorine atom at the 3′ position and two methyl groups at the 4,4′ positions, which can influence its chemical reactivity and physical properties. The fluorine substitution can enhance lipophilicity and potentially alter the compound's biological activity. This compound may exhibit interesting properties such as solubility in organic solvents, and its structural features suggest potential applications in pharmaceuticals or materials science. Additionally, the presence of multiple functional groups can lead to diverse reactivity patterns, making it a subject of interest in synthetic organic chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C14H13FO
InChI:InChI=1S/C14H13FO/c1-9-3-5-11(7-13(9)15)12-6-4-10(2)14(16)8-12/h3-8,16H,1-2H3
InChI key:InChIKey=IHSYKHOSFXXJEY-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1C)C2=CC(O)=C(C)C=C2
Synonyms:
  • 3′-Fluoro-4,4′-dimethyl[1,1′-biphenyl]-3-ol
  • [1,1′-Biphenyl]-3-ol, 3′-fluoro-4,4′-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.