CAS 1261894-39-6

N-(3′-Fluoro-4′-hydroxy[1,1′-biphenyl]-3-yl)methanesulfonamide

Description:

N-(3′-Fluoro-4′-hydroxy[1,1′-biphenyl]-3-yl)methanesulfonamide is a chemical compound characterized by its unique structural features, which include a biphenyl moiety substituted with a fluorine atom and a hydroxy group, along with a methanesulfonamide functional group. This compound is likely to exhibit properties typical of sulfonamides, such as potential antibacterial activity, due to the presence of the sulfonamide functional group. The fluorine substitution can enhance lipophilicity and influence the compound's biological activity, while the hydroxy group may contribute to hydrogen bonding interactions. The compound's molecular structure suggests it may be soluble in organic solvents and exhibit moderate stability under standard conditions. Its specific applications and reactivity would depend on the context of its use, particularly in medicinal chemistry or material science. As with many organic compounds, safety and handling precautions should be observed, given the potential for biological activity and the presence of fluorine, which can impart unique toxicological properties.

Formula: C₁₃H₁₂FNO₃S

InChI: InChI=1S/C13H12FNO3S/c1-19(17,18)15-11-4-2-3-9(7-11)10-5-6-13(16)12(14)8-10/h2-8,15-16H,1H3

InChI key: InChIKey=USTDRCDUYOVPML-UHFFFAOYSA-N

SMILES: N(S(C)(=O)=O)C=1C=C(C=CC1)C2=CC(F)=C(O)C=C2

Synonyms:

• Methanesulfonamide, N-(3′-fluoro-4′-hydroxy[1,1′-biphenyl]-3-yl)-
• N-(3′-Fluoro-4′-hydroxy[1,1′-biphenyl]-3-yl)methanesulfonamide