CAS 1261894-43-2

4-Fluoro-2′-(methylthio)[1,1′-biphenyl]-3-carboxylic acid

Description:

4-Fluoro-2′-(methylthio)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. The fluorine substituent at the 4-position of the biphenyl ring introduces electronegativity, potentially influencing the compound's reactivity and polarity. Additionally, the methylthio group (-S-CH3) at the 2′ position contributes to the compound's overall hydrophobic character and may affect its biological activity. This compound may exhibit interesting properties such as solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals, depending on its specific interactions with biological systems. Its unique structure and functional groups suggest that it could participate in various chemical reactions, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₄H₁₁FO₂S

InChI: InChI=1S/C14H11FO2S/c1-18-13-5-3-2-4-10(13)9-6-7-12(15)11(8-9)14(16)17/h2-8H,1H3,(H,16,17)

InChI key: InChIKey=LMILOEHZYUCYJR-UHFFFAOYSA-N

SMILES: S(C)C1=C(C2=CC(C(O)=O)=C(F)C=C2)C=CC=C1

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 4-fluoro-2′-(methylthio)-
• 4-Fluoro-2′-(methylthio)[1,1′-biphenyl]-3-carboxylic acid