
CAS 1261894-83-0
:1-[4-(5-Hydroxy-2-pyridinyl)phenyl]ethanone
Description:
1-[4-(5-Hydroxy-2-pyridinyl)phenyl]ethanone, with the CAS number 1261894-83-0, is an organic compound characterized by its complex structure that includes a ketone functional group and a pyridine ring. This substance features a phenyl group substituted with a hydroxyl group and a pyridine moiety, which contributes to its potential biological activity. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The compound is likely to be a solid at room temperature, with potential applications in pharmaceuticals or as a chemical intermediate due to its unique structural features. Its molecular interactions may be significant in biological systems, making it a candidate for further research in medicinal chemistry. As with many organic compounds, its stability, reactivity, and potential toxicity would need to be evaluated in specific contexts to determine its practical applications and safety profile.
Formula:C13H11NO2
InChI:InChI=1S/C13H11NO2/c1-9(15)10-2-4-11(5-3-10)13-7-6-12(16)8-14-13/h2-8,16H,1H3
InChI key:InChIKey=RMKZEZKAMNBCOF-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=CC=C(C=C1)C2=CC=C(O)C=N2
Synonyms:- 1-[4-(5-Hydroxypyridin-2-yl)phenyl]ethan-1-one
- 1-[4-(5-Hydroxy-2-pyridinyl)phenyl]ethanone
- Ethanone, 1-[4-(5-hydroxy-2-pyridinyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.