CymitQuimica logo

CAS 1261894-87-4

:

4-(3-Chloro-5-fluorophenyl)-3-pyridinecarboxylic acid

Description:
4-(3-Chloro-5-fluorophenyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of a chloro and a fluoro substituent on the phenyl ring contributes to its potential reactivity and biological activity. This compound typically exhibits moderate to high solubility in polar solvents due to the carboxylic acid group, while its aromatic and heterocyclic components may influence its lipophilicity. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the specific substitutions can affect the compound's interaction with biological targets. Additionally, the compound may exhibit interesting properties such as acidity, which can be influenced by the electron-withdrawing effects of the halogen substituents. Overall, 4-(3-Chloro-5-fluorophenyl)-3-pyridinecarboxylic acid is a compound of interest for further research in various chemical and biological contexts.
Formula:C12H7ClFNO2
InChI:InChI=1S/C12H7ClFNO2/c13-8-3-7(4-9(14)5-8)10-1-2-15-6-11(10)12(16)17/h1-6H,(H,16,17)
InChI key:InChIKey=WAVQJDCASBEUHV-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(C2=CC(Cl)=CC(F)=C2)=CC=NC1
Synonyms:
  • 3-Pyridinecarboxylic acid, 4-(3-chloro-5-fluorophenyl)-
  • 4-(3-Chloro-5-fluorophenyl)-3-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.