CAS 1261894-95-4

4-(3,5-Dimethoxyphenyl)-3-pyridinecarboxylic acid

Description:

4-(3,5-Dimethoxyphenyl)-3-pyridinecarboxylic acid, identified by its CAS number 1261894-95-4, is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with two methoxy groups. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. It is likely to be a solid at room temperature, with solubility in organic solvents due to its aromatic nature. The presence of the carboxylic acid functional group suggests it can participate in acid-base reactions and may form salts or esters. Additionally, the methoxy groups can influence its electronic properties and reactivity, potentially enhancing its biological activity. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in organic synthesis. Overall, 4-(3,5-Dimethoxyphenyl)-3-pyridinecarboxylic acid represents a versatile structure with significant implications in various chemical fields.

Formula: C₁₄H₁₃NO₄

InChI: InChI=1S/C14H13NO4/c1-18-10-5-9(6-11(7-10)19-2)12-3-4-15-8-13(12)14(16)17/h3-8H,1-2H3,(H,16,17)

InChI key: InChIKey=PPYJISIKKSSMMC-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(C2=CC(OC)=CC(OC)=C2)=CC=NC1

Synonyms:

• 3-Pyridinecarboxylic acid, 4-(3,5-dimethoxyphenyl)-
• 4-(3,5-Dimethoxyphenyl)-3-pyridinecarboxylic acid