CAS 1261895-14-0

3′-Fluoro-2-hydroxy-4′-methoxy[1,1′-biphenyl]-3-carboxaldehyde

Description:

3′-Fluoro-2-hydroxy-4′-methoxy[1,1′-biphenyl]-3-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 3′ position introduces electronegative characteristics, potentially influencing the compound's reactivity and polarity. The hydroxyl group at the 2-position contributes to its solubility in polar solvents and can participate in hydrogen bonding, enhancing its potential as a ligand in coordination chemistry. The methoxy group at the 4′ position serves as an electron-donating substituent, which can stabilize the aromatic system and affect the compound's electronic properties. Additionally, the aldehyde functional group at the 3-position is reactive, making the compound suitable for further chemical transformations. Overall, this compound exhibits a combination of functional groups that can impart unique chemical behavior, making it of interest in various fields, including medicinal chemistry and materials science. Its specific properties, such as melting point, boiling point, and spectral data, would require experimental determination or literature reference for precise characterization.

Formula: C₁₄H₁₁FO₃

InChI: InChI=1S/C14H11FO3/c1-18-13-6-5-9(7-12(13)15)11-4-2-3-10(8-16)14(11)17/h2-8,17H,1H3

InChI key: InChIKey=MGVUCBSMWMWJII-UHFFFAOYSA-N

SMILES: OC1=C(C2=CC(F)=C(OC)C=C2)C=CC=C1C=O

Synonyms:

• 3′-Fluoro-2-hydroxy-4′-methoxy[1,1′-biphenyl]-3-carboxaldehyde
• [1,1′-Biphenyl]-3-carboxaldehyde, 3′-fluoro-2-hydroxy-4′-methoxy-
• 6-(3-Fluoro-4-methoxyphenyl)-2-formylphenol