
CAS 1261895-16-2
:2′-Chloro-3-hydroxy-4′-methyl[1,1′-biphenyl]-4-carboxaldehyde
Description:
2′-Chloro-3-hydroxy-4′-methyl[1,1′-biphenyl]-4-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 2′ position and a hydroxyl group at the 3 position contributes to its reactivity and potential applications in various chemical reactions. The 4′-methyl group adds to the compound's hydrophobic character, while the aldehyde functional group at the 4 position makes it a versatile intermediate in organic synthesis. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Its solubility and stability can be influenced by the substituents on the biphenyl framework, which can affect its interactions in biological systems or with other chemical entities. Overall, 2′-Chloro-3-hydroxy-4′-methyl[1,1′-biphenyl]-4-carboxaldehyde is a compound with potential utility in research and industrial applications, particularly in the synthesis of more complex organic molecules.
Formula:C14H11ClO2
InChI:InChI=1S/C14H11ClO2/c1-9-2-5-12(13(15)6-9)10-3-4-11(8-16)14(17)7-10/h2-8,17H,1H3
InChI key:InChIKey=RISRYWQSTOALIL-UHFFFAOYSA-N
SMILES:ClC1=C(C=CC(C)=C1)C2=CC(O)=C(C=O)C=C2
Synonyms:- [1,1′-Biphenyl]-4-carboxaldehyde, 2′-chloro-3-hydroxy-4′-methyl-
- 2′-Chloro-3-hydroxy-4′-methyl[1,1′-biphenyl]-4-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.