CAS 1261895-24-2

3-Hydroxy-2′,4′-dimethoxy[1,1′-biphenyl]-4-carboxaldehyde

Description:

3-Hydroxy-2′,4′-dimethoxy[1,1′-biphenyl]-4-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) and two methoxy groups (-OCH3) attached to the biphenyl framework, contributing to its chemical reactivity and solubility properties. The presence of the carboxaldehyde functional group (-CHO) indicates that it can participate in various chemical reactions, such as oxidation and condensation. Its molecular structure suggests potential applications in organic synthesis, pharmaceuticals, and as a building block in the development of more complex molecules. The compound's specific properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Additionally, its biological activity and potential uses in medicinal chemistry would require further investigation through experimental studies. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical research and applications.

Formula: C₁₅H₁₄O₄

InChI: InChI=1S/C15H14O4/c1-18-12-5-6-13(15(8-12)19-2)10-3-4-11(9-16)14(17)7-10/h3-9,17H,1-2H3

InChI key: InChIKey=COXDJDBCYFVWFA-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC(OC)=C1)C2=CC(O)=C(C=O)C=C2

Synonyms:

• 3-Hydroxy-2′,4′-dimethoxy[1,1′-biphenyl]-4-carboxaldehyde
• [1,1′-Biphenyl]-4-carboxaldehyde, 3-hydroxy-2′,4′-dimethoxy-

5-(2,4-Dimethoxyphenyl)-2-formylphenol

Controlled Product

CAS: 1261895-24-2

Please enquire for more information about 5-(2,4-Dimethoxyphenyl)-2-formylphenol including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₅H₁₄O₄

Purity: Min. 95%

Molecular weight: 258.27 g/mol

Ref: 3D-LAC89524