CymitQuimica logo

CAS 1261895-38-8

:

N-Cyclopropyl-4′-formyl-3′-hydroxy[1,1′-biphenyl]-3-carboxamide

Description:
N-Cyclopropyl-4′-formyl-3′-hydroxy[1,1′-biphenyl]-3-carboxamide is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with a cyclopropyl group, a formyl group, a hydroxy group, and a carboxamide functional group. This compound is likely to exhibit unique physical and chemical properties due to the presence of these functional groups, which can influence its reactivity, solubility, and potential biological activity. The cyclopropyl moiety may impart strain and contribute to the compound's overall stability and reactivity. The hydroxyl group can participate in hydrogen bonding, enhancing solubility in polar solvents, while the formyl and carboxamide groups may play roles in intermolecular interactions. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in organic synthesis. Further studies would be necessary to elucidate its specific properties and potential applications in various fields.
Formula:C17H15NO3
InChI:InChI=1S/C17H15NO3/c19-10-14-5-4-12(9-16(14)20)11-2-1-3-13(8-11)17(21)18-15-6-7-15/h1-5,8-10,15,20H,6-7H2,(H,18,21)
InChI key:InChIKey=FYWPOXACPOMEOE-UHFFFAOYSA-N
SMILES:C(NC1CC1)(=O)C=2C=C(C=CC2)C3=CC(O)=C(C=O)C=C3
Synonyms:
  • [1,1′-Biphenyl]-3-carboxamide, N-cyclopropyl-4′-formyl-3′-hydroxy-
  • N-Cyclopropyl-4′-formyl-3′-hydroxy[1,1′-biphenyl]-3-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.